C19H21FN4OS — CID 155812103
4-(4-fluorophenyl)-2-(2-methylpropylsulfanyl)-6-morpholin-4-ylpyrimidine-5-carbonitrile (PubChem CID 155812103) has the molecular formula C19H21FN4OS and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-(2-methylpropylsulfanyl)-6-morpholin-4-ylpyrimidine-5-carbonitrile.
| Compound Name | 4-(4-fluorophenyl)-2-(2-methylpropylsulfanyl)-6-morpholin-4-ylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 155812103 |
| Molecular Formula | C19H21FN4OS |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-(4-fluorophenyl)-2-(2-methylpropylsulfanyl)-6-morpholin-4-ylpyrimidine-5-carbonitrile |
| SMILES | CC(C)CSc1nc(-c2ccc(F)cc2)c(C#N)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H21FN4OS/c1-13(2)12-26-19-22-17(14-3-5-15(20)6-4-14)16(11-21)18(23-19)24-7-9-25-10-8-24/h3-6,13H,7-10,12H2,1-2H3 |
| InChIKey | KRLITVHNVXUGAZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |