C16H15N3S2 — CID 110826182
N-benzyl-3-benzylsulfanyl-1,2,4-thiadiazol-5-amine (PubChem CID 110826182) has the molecular formula C16H15N3S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is N-benzyl-3-benzylsulfanyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-benzyl-3-benzylsulfanyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 110826182 |
| Molecular Formula | C16H15N3S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-benzyl-3-benzylsulfanyl-1,2,4-thiadiazol-5-amine |
| SMILES | c1ccc(CNc2nc(SCc3ccccc3)ns2)cc1 |
| InChI | InChI=1S/C16H15N3S2/c1-3-7-13(8-4-1)11-17-15-18-16(19-21-15)20-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,17,18,19) |
| InChIKey | CVZXSJUTXUENBJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |