C16H12BrN3OS2 — CID 2472346
N-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-3-bromobenzamide (PubChem CID 2472346) has the molecular formula C16H12BrN3OS2 and a molecular weight of 406.33 g/mol. Its IUPAC name is N-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-3-bromobenzamide.
| Compound Name | N-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-3-bromobenzamide |
|---|---|
| PubChem CID | 2472346 |
| Molecular Formula | C16H12BrN3OS2 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 404.96 |
| IUPAC Name | N-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-3-bromobenzamide |
| SMILES | O=C(Nc1nc(SCc2ccccc2)ns1)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H12BrN3OS2/c17-13-8-4-7-12(9-13)14(21)18-15-19-16(20-23-15)22-10-11-5-2-1-3-6-11/h1-9H,10H2,(H,18,19,20,21) |
| InChIKey | SORQAHUDPMHEHT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |