C16H13ClN4OS2 — CID 46249565
1-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(4-chlorophenyl)urea (PubChem CID 46249565) has the molecular formula C16H13ClN4OS2 and a molecular weight of 376.89 g/mol. Its IUPAC name is 1-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(4-chlorophenyl)urea.
| Compound Name | 1-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 46249565 |
| Molecular Formula | C16H13ClN4OS2 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 1-(3-benzylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(4-chlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1nc(SCc2ccccc2)ns1 |
| InChI | InChI=1S/C16H13ClN4OS2/c17-12-6-8-13(9-7-12)18-14(22)19-15-20-16(21-24-15)23-10-11-4-2-1-3-5-11/h1-9H,10H2,(H2,18,19,20,21,22) |
| InChIKey | KEXFEPRDSWTKQZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |