C22H24N4OS2 — CID 15979338
4-benzylsulfanyl-2-methylsulfanyl-6-(3-phenylpropylamino)pyrimidine-5-carboxamide (PubChem CID 15979338) has the molecular formula C22H24N4OS2 and a molecular weight of 424.60 g/mol. Its IUPAC name is 4-benzylsulfanyl-2-methylsulfanyl-6-(3-phenylpropylamino)pyrimidine-5-carboxamide.
| Compound Name | 4-benzylsulfanyl-2-methylsulfanyl-6-(3-phenylpropylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 15979338 |
| Molecular Formula | C22H24N4OS2 |
| Molecular Weight | 424.60 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 4-benzylsulfanyl-2-methylsulfanyl-6-(3-phenylpropylamino)pyrimidine-5-carboxamide |
| SMILES | CSc1nc(NCCCc2ccccc2)c(C(N)=O)c(SCc2ccccc2)n1 |
| InChI | InChI=1S/C22H24N4OS2/c1-28-22-25-20(24-14-8-13-16-9-4-2-5-10-16)18(19(23)27)21(26-22)29-15-17-11-6-3-7-12-17/h2-7,9-12H,8,13-15H2,1H3,(H2,23,27)(H,24,25,26) |
| InChIKey | UPARBHFAZLXZPH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|