C15H19N5O2 — CID 135604867
2-amino-6-oxo-4-(4-phenylbutylamino)-1H-pyrimidine-5-carboxamide (PubChem CID 135604867) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-amino-6-oxo-4-(4-phenylbutylamino)-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-amino-6-oxo-4-(4-phenylbutylamino)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135604867 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-amino-6-oxo-4-(4-phenylbutylamino)-1H-pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1c(NCCCCc2ccccc2)nc(N)[nH]c1=O |
| InChI | InChI=1S/C15H19N5O2/c16-12(21)11-13(19-15(17)20-14(11)22)18-9-5-4-8-10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H2,16,21)(H4,17,18,19,20,22) |
| InChIKey | JBIOFYGRBYNUOT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|