C17H19N3O3 — CID 135532975
3-[2-amino-6-oxo-5-(4-phenylbutyl)-1H-pyrimidin-4-yl]prop-2-enoic acid (PubChem CID 135532975) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-[2-amino-6-oxo-5-(4-phenylbutyl)-1H-pyrimidin-4-yl]prop-2-enoic acid.
| Compound Name | 3-[2-amino-6-oxo-5-(4-phenylbutyl)-1H-pyrimidin-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 135532975 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 3-[2-amino-6-oxo-5-(4-phenylbutyl)-1H-pyrimidin-4-yl]prop-2-enoic acid |
| SMILES | Nc1nc(C=CC(=O)O)c(CCCCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H19N3O3/c18-17-19-14(10-11-15(21)22)13(16(23)20-17)9-5-4-8-12-6-2-1-3-7-12/h1-3,6-7,10-11H,4-5,8-9H2,(H,21,22)(H3,18,19,20,23) |
| InChIKey | HSINWBUCMFGRRB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|