C52H64Br2N8O8S — CID 137190020
bis(N-[4-[4-[2-amino-6-oxo-5-(4-phenylbutyl)-1H-pyrimidin-4-yl]butyl]phenyl]-2-bromoacetamide);sulfuric acid (PubChem CID 137190020) has the molecular formula C52H64Br2N8O8S and a molecular weight of 1121.01 g/mol. Its IUPAC name is bis(N-[4-[4-[2-amino-6-oxo-5-(4-phenylbutyl)-1H-pyrimidin-4-yl]butyl]phenyl]-2-bromoacetamide);sulfuric acid.
| Compound Name | bis(N-[4-[4-[2-amino-6-oxo-5-(4-phenylbutyl)-1H-pyrimidin-4-yl]butyl]phenyl]-2-bromoacetamide);sulfuric acid |
|---|---|
| PubChem CID | 137190020 |
| Molecular Formula | C52H64Br2N8O8S |
| Molecular Weight | 1121.01 g/mol |
| Exact Mass | 1118.29 |
| IUPAC Name | bis(N-[4-[4-[2-amino-6-oxo-5-(4-phenylbutyl)-1H-pyrimidin-4-yl]butyl]phenyl]-2-bromoacetamide);sulfuric acid |
| SMILES | Nc1nc(CCCCc2ccc(NC(=O)CBr)cc2)c(CCCCc2ccccc2)c(=O)[nH]1.Nc1nc(CCCCc2ccc(NC(=O)CBr)cc2)c(CCCCc2ccccc2)c(=O)[nH]1.O=S(=O)(O)O |
| InChI | InChI=1S/2C26H31BrN4O2.H2O4S/c2*27-18-24(32)29-21-16-14-20(15-17-21)11-5-7-13-23-22(25(33)31-26(28)30-23)12-6-4-10-19-8-2-1-3-9-19;1-5(2,3)4/h2*1-3,8-9,14-17H,4-7,10-13,18H2,(H,29,32)(H3,28,30,31,33);(H2,1,2,3,4) |
| InChIKey | AYLIMGXWJLDIIX-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 276.34 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1121.01 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|