C24H29BrN4O6S — CID 135509581
N-[4-[2-[2-amino-6-oxo-5-(4-phenylbutyl)-1H-pyrimidin-4-yl]ethyl]phenyl]-2-bromoacetamide;sulfuric acid (PubChem CID 135509581) has the molecular formula C24H29BrN4O6S and a molecular weight of 581.49 g/mol. Its IUPAC name is N-[4-[2-[2-amino-6-oxo-5-(4-phenylbutyl)-1H-pyrimidin-4-yl]ethyl]phenyl]-2-bromoacetamide;sulfuric acid.
| Compound Name | N-[4-[2-[2-amino-6-oxo-5-(4-phenylbutyl)-1H-pyrimidin-4-yl]ethyl]phenyl]-2-bromoacetamide;sulfuric acid |
|---|---|
| PubChem CID | 135509581 |
| Molecular Formula | C24H29BrN4O6S |
| Molecular Weight | 581.49 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | N-[4-[2-[2-amino-6-oxo-5-(4-phenylbutyl)-1H-pyrimidin-4-yl]ethyl]phenyl]-2-bromoacetamide;sulfuric acid |
| SMILES | Nc1nc(CCc2ccc(NC(=O)CBr)cc2)c(CCCCc2ccccc2)c(=O)[nH]1.O=S(=O)(O)O |
| InChI | InChI=1S/C24H27BrN4O2.H2O4S/c25-16-22(30)27-19-13-10-18(11-14-19)12-15-21-20(23(31)29-24(26)28-21)9-5-4-8-17-6-2-1-3-7-17;1-5(2,3)4/h1-3,6-7,10-11,13-14H,4-5,8-9,12,15-16H2,(H,27,30)(H3,26,28,29,31);(H2,1,2,3,4) |
| InChIKey | XUPATJTXIGNRDV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 175.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|