C40H40Br2Cl2N10O6S — CID 131874912
bis(2-bromo-N-[4-[2-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]phenyl]acetamide);sulfuric acid (PubChem CID 131874912) has the molecular formula C40H40Br2Cl2N10O6S and a molecular weight of 1019.60 g/mol. Its IUPAC name is bis(2-bromo-N-[4-[2-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]phenyl]acetamide);sulfuric acid.
| Compound Name | bis(2-bromo-N-[4-[2-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]phenyl]acetamide);sulfuric acid |
|---|---|
| PubChem CID | 131874912 |
| Molecular Formula | C40H40Br2Cl2N10O6S |
| Molecular Weight | 1019.60 g/mol |
| Exact Mass | 1016.06 |
| IUPAC Name | bis(2-bromo-N-[4-[2-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]phenyl]acetamide);sulfuric acid |
| SMILES | Nc1nc(N)c(-c2ccc(Cl)cc2)c(CCc2ccc(NC(=O)CBr)cc2)n1.Nc1nc(N)c(-c2ccc(Cl)cc2)c(CCc2ccc(NC(=O)CBr)cc2)n1.O=S(=O)(O)O |
| InChI | InChI=1S/2C20H19BrClN5O.H2O4S/c2*21-11-17(28)25-15-8-1-12(2-9-15)3-10-16-18(19(23)27-20(24)26-16)13-4-6-14(22)7-5-13;1-5(2,3)4/h2*1-2,4-9H,3,10-11H2,(H,25,28)(H4,23,24,26,27);(H2,1,2,3,4) |
| InChIKey | BFBRYYWZXFGFIZ-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 288.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.60 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|