C16H19N3O3 — CID 135450708
5-(2-amino-4-benzyl-6-oxo-1H-pyrimidin-5-yl)pentanoic acid (PubChem CID 135450708) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 5-(2-amino-4-benzyl-6-oxo-1H-pyrimidin-5-yl)pentanoic acid.
| Compound Name | 5-(2-amino-4-benzyl-6-oxo-1H-pyrimidin-5-yl)pentanoic acid |
|---|---|
| PubChem CID | 135450708 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 5-(2-amino-4-benzyl-6-oxo-1H-pyrimidin-5-yl)pentanoic acid |
| SMILES | Nc1nc(Cc2ccccc2)c(CCCCC(=O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C16H19N3O3/c17-16-18-13(10-11-6-2-1-3-7-11)12(15(22)19-16)8-4-5-9-14(20)21/h1-3,6-7H,4-5,8-10H2,(H,20,21)(H3,17,18,19,22) |
| InChIKey | JMTZBSMJOAPKJJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|