C18H14F4O2 — CID 122214214
(E)-3-[2,3,5,6-tetrafluoro-4-(3-phenylpropyl)phenyl]prop-2-enoic acid (PubChem CID 122214214) has the molecular formula C18H14F4O2 and a molecular weight of 338.30 g/mol. Its IUPAC name is (E)-3-[2,3,5,6-tetrafluoro-4-(3-phenylpropyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2,3,5,6-tetrafluoro-4-(3-phenylpropyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 122214214 |
| Molecular Formula | C18H14F4O2 |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (E)-3-[2,3,5,6-tetrafluoro-4-(3-phenylpropyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1c(F)c(F)c(CCCc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C18H14F4O2/c19-15-12(8-4-7-11-5-2-1-3-6-11)16(20)18(22)13(17(15)21)9-10-14(23)24/h1-3,5-6,9-10H,4,7-8H2,(H,23,24)/b10-9+ |
| InChIKey | QDDNXMMBOIUBJQ-MDZDMXLPSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|