About (carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide
(carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide (PubChem CID 162266552) has the molecular formula C17H21IN2O4
and a molecular weight of 444.27 g/mol. Its IUPAC name is (carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide.
Molecular Properties
| Compound Name | (carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide |
| PubChem CID | 162266552 |
| Molecular Formula | C17H21IN2O4 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | (carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide |
| SMILES | I.O=C(O)NNC(=O)O.c1ccc(CCCc2ccccc2)cc1 |
| InChI | InChI=1S/C15H16.C2H4N2O4.HI/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15;5-1(6)3-4-2(7)8;/h1-6,8-11H,7,12-13H2;3-4H,(H,5,6)(H,7,8);1H |
| InChIKey | WJSOOZZYKPQJTO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide?
The IUPAC name of (carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide (CID 162266552) is (carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide.
What is the SMILES notation for (carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide?
The canonical SMILES for (carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide is I.O=C(O)NNC(=O)O.c1ccc(CCCc2ccccc2)cc1.
What is the InChIKey of (carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide?
The InChIKey is WJSOOZZYKPQJTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16.C2H4N2O4.HI/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15;5-1(6)3-4-2(7)8;/h1-6,8-11H,7,12-13H2;3-4H,(H,5,6)(H,7,8);1H.
What are the key properties of (carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide?
(carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide has a molecular weight of 444.27 g/mol, XLogP of 3.92, 4 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (carboxyamino)carbamic acid;3-phenylpropylbenzene;hydroiodide is sourced from PubChem (CID 162266552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).