C20H20N6O2 — CID 135692618
2-amino-4-[(2-oxo-4-phenylbutyl)amino]-5-phenyldiazenyl-1H-pyrimidin-6-one (PubChem CID 135692618) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 2-amino-4-[(2-oxo-4-phenylbutyl)amino]-5-phenyldiazenyl-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-[(2-oxo-4-phenylbutyl)amino]-5-phenyldiazenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135692618 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-amino-4-[(2-oxo-4-phenylbutyl)amino]-5-phenyldiazenyl-1H-pyrimidin-6-one |
| SMILES | Nc1nc(NCC(=O)CCc2ccccc2)c(/N=N/c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C20H20N6O2/c21-20-23-18(22-13-16(27)12-11-14-7-3-1-4-8-14)17(19(28)24-20)26-25-15-9-5-2-6-10-15/h1-10H,11-13H2,(H4,21,22,23,24,28)/b26-25+ |
| InChIKey | ZKDSDCJKKKRJMU-OCEACIFDSA-N |
| XLogP | 3.38 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|