C15H16ClN5O2S — CID 130466488
ethyl 2-[[6-chloro-5-phenyldiazenyl-2-(sulfanylmethyl)pyrimidin-4-yl]amino]acetate (PubChem CID 130466488) has the molecular formula C15H16ClN5O2S and a molecular weight of 365.85 g/mol. Its IUPAC name is ethyl 2-[[6-chloro-5-phenyldiazenyl-2-(sulfanylmethyl)pyrimidin-4-yl]amino]acetate.
| Compound Name | ethyl 2-[[6-chloro-5-phenyldiazenyl-2-(sulfanylmethyl)pyrimidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 130466488 |
| Molecular Formula | C15H16ClN5O2S |
| Molecular Weight | 365.85 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | ethyl 2-[[6-chloro-5-phenyldiazenyl-2-(sulfanylmethyl)pyrimidin-4-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1nc(CS)nc(Cl)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C15H16ClN5O2S/c1-2-23-12(22)8-17-15-13(14(16)18-11(9-24)19-15)21-20-10-6-4-3-5-7-10/h3-7,24H,2,8-9H2,1H3,(H,17,18,19)/b21-20+ |
| InChIKey | GYVBTUAUKXDNRH-QZQOTICOSA-N |
| XLogP | 3.95 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|