C14H16ClN5O2 — CID 779533
ethyl 2-[[4-(benzylamino)-6-chloro-1,3,5-triazin-2-yl]amino]acetate (PubChem CID 779533) has the molecular formula C14H16ClN5O2 and a molecular weight of 321.77 g/mol. Its IUPAC name is ethyl 2-[[4-(benzylamino)-6-chloro-1,3,5-triazin-2-yl]amino]acetate.
| Compound Name | ethyl 2-[[4-(benzylamino)-6-chloro-1,3,5-triazin-2-yl]amino]acetate |
|---|---|
| PubChem CID | 779533 |
| Molecular Formula | C14H16ClN5O2 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | ethyl 2-[[4-(benzylamino)-6-chloro-1,3,5-triazin-2-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1nc(Cl)nc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C14H16ClN5O2/c1-2-22-11(21)9-17-14-19-12(15)18-13(20-14)16-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | GKHFSHLEONMARN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |