C14H18N6 — CID 54014902
4-N-benzyl-2-N-(2-methylprop-2-enyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 54014902) has the molecular formula C14H18N6 and a molecular weight of 270.34 g/mol. Its IUPAC name is 4-N-benzyl-2-N-(2-methylprop-2-enyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-benzyl-2-N-(2-methylprop-2-enyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 54014902 |
| Molecular Formula | C14H18N6 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 4-N-benzyl-2-N-(2-methylprop-2-enyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | C=C(C)CNc1nc(N)nc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C14H18N6/c1-10(2)8-16-13-18-12(15)19-14(20-13)17-9-11-6-4-3-5-7-11/h3-7H,1,8-9H2,2H3,(H4,15,16,17,18,19,20) |
| InChIKey | KUYKDVBRQBUCBG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|