C15H26N6O — CID 91501774
2-N,4-N-diethyl-1,3,5-triazine-2,4,6-triamine;ethane;phenol (PubChem CID 91501774) has the molecular formula C15H26N6O and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-N,4-N-diethyl-1,3,5-triazine-2,4,6-triamine;ethane;phenol.
| Compound Name | 2-N,4-N-diethyl-1,3,5-triazine-2,4,6-triamine;ethane;phenol |
|---|---|
| PubChem CID | 91501774 |
| Molecular Formula | C15H26N6O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 2-N,4-N-diethyl-1,3,5-triazine-2,4,6-triamine;ethane;phenol |
| SMILES | CC.CCNc1nc(N)nc(NCC)n1.Oc1ccccc1 |
| InChI | InChI=1S/C7H14N6.C6H6O.C2H6/c1-3-9-6-11-5(8)12-7(13-6)10-4-2;7-6-4-2-1-3-5-6;1-2/h3-4H2,1-2H3,(H4,8,9,10,11,12,13);1-5,7H;1-2H3 |
| InChIKey | VGQHZYAWXYJTHG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |