C12H12N8 — CID 80770243
2-N-benzyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 80770243) has the molecular formula C12H12N8 and a molecular weight of 268.28 g/mol. Its IUPAC name is 2-N-benzyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-benzyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80770243 |
| Molecular Formula | C12H12N8 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-N-benzyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(NCc2ccccc2)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C12H12N8/c13-10-17-11(15-6-9-4-2-1-3-5-9)19-12(18-10)20-8-14-7-16-20/h1-5,7-8H,6H2,(H3,13,15,17,18,19) |
| InChIKey | MTHULNPXRKZNKU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |