C10H11N9O — CID 80814258
2-N-[(3-methyl-1,2-oxazol-5-yl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 80814258) has the molecular formula C10H11N9O and a molecular weight of 273.26 g/mol. Its IUPAC name is 2-N-[(3-methyl-1,2-oxazol-5-yl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(3-methyl-1,2-oxazol-5-yl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80814258 |
| Molecular Formula | C10H11N9O |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-N-[(3-methyl-1,2-oxazol-5-yl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(CNc2nc(N)nc(-n3cncn3)n2)on1 |
| InChI | InChI=1S/C10H11N9O/c1-6-2-7(20-18-6)3-13-9-15-8(11)16-10(17-9)19-5-12-4-14-19/h2,4-5H,3H2,1H3,(H3,11,13,15,16,17) |
| InChIKey | QYRSLJZGOZHHAF-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |