C11H14N6 — CID 25211898
2-N-[(4-methylphenyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 25211898) has the molecular formula C11H14N6 and a molecular weight of 230.28 g/mol. Its IUPAC name is 2-N-[(4-methylphenyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(4-methylphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 25211898 |
| Molecular Formula | C11H14N6 |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-N-[(4-methylphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ccc(CNc2nc(N)nc(N)n2)cc1 |
| InChI | InChI=1S/C11H14N6/c1-7-2-4-8(5-3-7)6-14-11-16-9(12)15-10(13)17-11/h2-5H,6H2,1H3,(H5,12,13,14,15,16,17) |
| InChIKey | SPZQSYPQCMNIJD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |