C27H35N7 — CID 91094549
2-N-(3-aminophenyl)-4-N,6-N-dibenzyl-1,3,5-triazine-2,4,6-triamine;ethane (PubChem CID 91094549) has the molecular formula C27H35N7 and a molecular weight of 457.63 g/mol. Its IUPAC name is 2-N-(3-aminophenyl)-4-N,6-N-dibenzyl-1,3,5-triazine-2,4,6-triamine;ethane.
| Compound Name | 2-N-(3-aminophenyl)-4-N,6-N-dibenzyl-1,3,5-triazine-2,4,6-triamine;ethane |
|---|---|
| PubChem CID | 91094549 |
| Molecular Formula | C27H35N7 |
| Molecular Weight | 457.63 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | 2-N-(3-aminophenyl)-4-N,6-N-dibenzyl-1,3,5-triazine-2,4,6-triamine;ethane |
| SMILES | CC.CC.Nc1cccc(Nc2nc(NCc3ccccc3)nc(NCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H23N7.2C2H6/c24-19-12-7-13-20(14-19)27-23-29-21(25-15-17-8-3-1-4-9-17)28-22(30-23)26-16-18-10-5-2-6-11-18;2*1-2/h1-14H,15-16,24H2,(H3,25,26,27,28,29,30);2*1-2H3 |
| InChIKey | OESHQMHNKVHSKE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.63 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|