C19H24N10 — CID 57316892
6-[2-[4-amino-6-(benzylamino)-1,3,5-triazin-2-yl]cyclohexyl]-1,3,5-triazine-2,4-diamine (PubChem CID 57316892) has the molecular formula C19H24N10 and a molecular weight of 392.47 g/mol. Its IUPAC name is 6-[2-[4-amino-6-(benzylamino)-1,3,5-triazin-2-yl]cyclohexyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[2-[4-amino-6-(benzylamino)-1,3,5-triazin-2-yl]cyclohexyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 57316892 |
| Molecular Formula | C19H24N10 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 6-[2-[4-amino-6-(benzylamino)-1,3,5-triazin-2-yl]cyclohexyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(C2CCCCC2c2nc(N)nc(NCc3ccccc3)n2)n1 |
| InChI | InChI=1S/C19H24N10/c20-16-24-14(25-17(21)28-16)12-8-4-5-9-13(12)15-26-18(22)29-19(27-15)23-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10H2,(H4,20,21,24,25,28)(H3,22,23,26,27,29) |
| InChIKey | UAHSKMWLAHSHJE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 167.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |