C18H19N5 — CID 100996925
2-N,4-N-dibenzylpyrimidine-2,4,6-triamine (PubChem CID 100996925) has the molecular formula C18H19N5 and a molecular weight of 305.39 g/mol. Its IUPAC name is 2-N,4-N-dibenzylpyrimidine-2,4,6-triamine.
| Compound Name | 2-N,4-N-dibenzylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 100996925 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-N,4-N-dibenzylpyrimidine-2,4,6-triamine |
| SMILES | Nc1cc(NCc2ccccc2)nc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C18H19N5/c19-16-11-17(20-12-14-7-3-1-4-8-14)23-18(22-16)21-13-15-9-5-2-6-10-15/h1-11H,12-13H2,(H4,19,20,21,22,23) |
| InChIKey | DSDHNLQVPUYBHR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |