C11H12N4 — CID 70838336
2-N-benzylpyrazine-2,6-diamine (PubChem CID 70838336) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is 2-N-benzylpyrazine-2,6-diamine.
| Compound Name | 2-N-benzylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 70838336 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 2-N-benzylpyrazine-2,6-diamine |
| SMILES | Nc1cncc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C11H12N4/c12-10-7-13-8-11(15-10)14-6-9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H3,12,14,15) |
| InChIKey | QLVIBMOVKWIHLE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |