C10H12N4S — CID 78988898
2-N-[(5-methylthiophen-2-yl)methyl]pyrazine-2,6-diamine (PubChem CID 78988898) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-N-[(5-methylthiophen-2-yl)methyl]pyrazine-2,6-diamine.
| Compound Name | 2-N-[(5-methylthiophen-2-yl)methyl]pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 78988898 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-N-[(5-methylthiophen-2-yl)methyl]pyrazine-2,6-diamine |
| SMILES | Cc1ccc(CNc2cncc(N)n2)s1 |
| InChI | InChI=1S/C10H12N4S/c1-7-2-3-8(15-7)4-13-10-6-12-5-9(11)14-10/h2-3,5-6H,4H2,1H3,(H3,11,13,14) |
| InChIKey | PJNDTZYRHFZQSZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |