C11H12N2S — CID 62057971
N-[(5-methylthiophen-2-yl)methyl]pyridin-4-amine (PubChem CID 62057971) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is N-[(5-methylthiophen-2-yl)methyl]pyridin-4-amine.
| Compound Name | N-[(5-methylthiophen-2-yl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 62057971 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | N-[(5-methylthiophen-2-yl)methyl]pyridin-4-amine |
| SMILES | Cc1ccc(CNc2ccncc2)s1 |
| InChI | InChI=1S/C11H12N2S/c1-9-2-3-11(14-9)8-13-10-4-6-12-7-5-10/h2-7H,8H2,1H3,(H,12,13) |
| InChIKey | JNXCYVMTNWJMSE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |