C11H10F2N4 — CID 78988973
2-N-[(3,4-difluorophenyl)methyl]pyrazine-2,6-diamine (PubChem CID 78988973) has the molecular formula C11H10F2N4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-N-[(3,4-difluorophenyl)methyl]pyrazine-2,6-diamine.
| Compound Name | 2-N-[(3,4-difluorophenyl)methyl]pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 78988973 |
| Molecular Formula | C11H10F2N4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2-N-[(3,4-difluorophenyl)methyl]pyrazine-2,6-diamine |
| SMILES | Nc1cncc(NCc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C11H10F2N4/c12-8-2-1-7(3-9(8)13)4-16-11-6-15-5-10(14)17-11/h1-3,5-6H,4H2,(H3,14,16,17) |
| InChIKey | YFUKXIUPVPHOPF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |