C22H21N7O2 — CID 135692617
4-[5-[(2-amino-6-oxo-5-phenyldiazenyl-1H-pyrimidin-4-yl)amino]-4-oxopentyl]benzonitrile (PubChem CID 135692617) has the molecular formula C22H21N7O2 and a molecular weight of 415.46 g/mol. Its IUPAC name is 4-[5-[(2-amino-6-oxo-5-phenyldiazenyl-1H-pyrimidin-4-yl)amino]-4-oxopentyl]benzonitrile.
| Compound Name | 4-[5-[(2-amino-6-oxo-5-phenyldiazenyl-1H-pyrimidin-4-yl)amino]-4-oxopentyl]benzonitrile |
|---|---|
| PubChem CID | 135692617 |
| Molecular Formula | C22H21N7O2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 4-[5-[(2-amino-6-oxo-5-phenyldiazenyl-1H-pyrimidin-4-yl)amino]-4-oxopentyl]benzonitrile |
| SMILES | N#Cc1ccc(CCCC(=O)CNc2nc(N)[nH]c(=O)c2/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N7O2/c23-13-16-11-9-15(10-12-16)5-4-8-18(30)14-25-20-19(21(31)27-22(24)26-20)29-28-17-6-2-1-3-7-17/h1-3,6-7,9-12H,4-5,8,14H2,(H4,24,25,26,27,31)/b29-28+ |
| InChIKey | ADXMHSOLDUCIJY-ZQHSETAFSA-N |
| XLogP | 3.64 |
| TPSA | 149.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|