C19H18N2O3 — CID 53349705
2-oxo-4-(3-phenylpropylamino)-1H-quinoline-3-carboxylic acid (PubChem CID 53349705) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-oxo-4-(3-phenylpropylamino)-1H-quinoline-3-carboxylic acid.
| Compound Name | 2-oxo-4-(3-phenylpropylamino)-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 53349705 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-oxo-4-(3-phenylpropylamino)-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c(NCCCc2ccccc2)c2ccccc2[nH]c1=O |
| InChI | InChI=1S/C19H18N2O3/c22-18-16(19(23)24)17(14-10-4-5-11-15(14)21-18)20-12-6-9-13-7-2-1-3-8-13/h1-5,7-8,10-11H,6,9,12H2,(H,23,24)(H2,20,21,22) |
| InChIKey | FETDLIFWLQEEIM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|