C19H14N2OS2 — CID 139230796
2-benzylsulfanyl-4-methylsulfanylindeno[1,2-d]pyrimidin-5-one (PubChem CID 139230796) has the molecular formula C19H14N2OS2 and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-benzylsulfanyl-4-methylsulfanylindeno[1,2-d]pyrimidin-5-one.
| Compound Name | 2-benzylsulfanyl-4-methylsulfanylindeno[1,2-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 139230796 |
| Molecular Formula | C19H14N2OS2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-benzylsulfanyl-4-methylsulfanylindeno[1,2-d]pyrimidin-5-one |
| SMILES | CSc1nc(SCc2ccccc2)nc2c1C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C19H14N2OS2/c1-23-18-15-16(13-9-5-6-10-14(13)17(15)22)20-19(21-18)24-11-12-7-3-2-4-8-12/h2-10H,11H2,1H3 |
| InChIKey | QJLOGBQPFLZLBL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |