C15H13NO5 — CID 139355426
2-(benzylcarbamoyl)-3,6-dihydroxybenzoic acid (PubChem CID 139355426) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-(benzylcarbamoyl)-3,6-dihydroxybenzoic acid.
| Compound Name | 2-(benzylcarbamoyl)-3,6-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 139355426 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-(benzylcarbamoyl)-3,6-dihydroxybenzoic acid |
| SMILES | O=C(O)c1c(O)ccc(O)c1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H13NO5/c17-10-6-7-11(18)13(15(20)21)12(10)14(19)16-8-9-4-2-1-3-5-9/h1-7,17-18H,8H2,(H,16,19)(H,20,21) |
| InChIKey | GBDWUPNLRWYWEQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|