About 1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide
1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide (PubChem CID 87853008) has the molecular formula C23H18N2O3
and a molecular weight of 370.41 g/mol. Its IUPAC name is 1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide |
| PubChem CID | 87853008 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide |
| SMILES | NC(=O)c1ccc2c(cc(O)c3ccccc32)c1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H18N2O3/c24-22(27)18-11-10-16-15-8-4-5-9-17(15)20(26)12-19(16)21(18)23(28)25-13-14-6-2-1-3-7-14/h1-12,26H,13H2,(H2,24,27)(H,25,28) |
| InChIKey | OYLUSZNPRVIWEH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide?
The IUPAC name of 1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide (CID 87853008) is 1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide.
What is the SMILES notation for 1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide?
The canonical SMILES for 1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide is NC(=O)c1ccc2c(cc(O)c3ccccc32)c1C(=O)NCc1ccccc1.
What is the InChIKey of 1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide?
The InChIKey is OYLUSZNPRVIWEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2O3/c24-22(27)18-11-10-16-15-8-4-5-9-17(15)20(26)12-19(16)21(18)23(28)25-13-14-6-2-1-3-7-14/h1-12,26H,13H2,(H2,24,27)(H,25,28).
What are the key properties of 1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide?
1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide has a molecular weight of 370.41 g/mol, XLogP of 3.73, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-benzyl-9-hydroxyphenanthrene-1,2-dicarboxamide is sourced from PubChem (CID 87853008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).