C21H16N2O4 — CID 135526570
5-(1,2-benzoxazol-3-yl)-N-benzyl-2,4-dihydroxybenzamide (PubChem CID 135526570) has the molecular formula C21H16N2O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is 5-(1,2-benzoxazol-3-yl)-N-benzyl-2,4-dihydroxybenzamide.
| Compound Name | 5-(1,2-benzoxazol-3-yl)-N-benzyl-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 135526570 |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 5-(1,2-benzoxazol-3-yl)-N-benzyl-2,4-dihydroxybenzamide |
| SMILES | O=C(NCc1ccccc1)c1cc(-c2noc3ccccc23)c(O)cc1O |
| InChI | InChI=1S/C21H16N2O4/c24-17-11-18(25)16(21(26)22-12-13-6-2-1-3-7-13)10-15(17)20-14-8-4-5-9-19(14)27-23-20/h1-11,24-25H,12H2,(H,22,26) |
| InChIKey | XJEIGAKOGROFHK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |