C24H17N3O3 — CID 97446275
N-benzyl-3-(2-phenyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide (PubChem CID 97446275) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is N-benzyl-3-(2-phenyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide.
| Compound Name | N-benzyl-3-(2-phenyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 97446275 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-benzyl-3-(2-phenyl-1,3-oxazol-4-yl)-1,2-benzoxazole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc2onc(-c3coc(-c4ccccc4)n3)c2c1 |
| InChI | InChI=1S/C24H17N3O3/c28-23(25-14-16-7-3-1-4-8-16)18-11-12-21-19(13-18)22(27-30-21)20-15-29-24(26-20)17-9-5-2-6-10-17/h1-13,15H,14H2,(H,25,28) |
| InChIKey | SYXLAXMFQATNNR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |