C21H18N2O5 — CID 73347970
2-benzamido-N-benzyl-3,4,5-trihydroxybenzamide (PubChem CID 73347970) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is 2-benzamido-N-benzyl-3,4,5-trihydroxybenzamide.
| Compound Name | 2-benzamido-N-benzyl-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 73347970 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-benzamido-N-benzyl-3,4,5-trihydroxybenzamide |
| SMILES | O=C(Nc1c(C(=O)NCc2ccccc2)cc(O)c(O)c1O)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O5/c24-16-11-15(21(28)22-12-13-7-3-1-4-8-13)17(19(26)18(16)25)23-20(27)14-9-5-2-6-10-14/h1-11,24-26H,12H2,(H,22,28)(H,23,27) |
| InChIKey | VYQFVFZWQVNTIH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|