C20H21N5O3 — CID 68777853
4-N-(1,2-benzoxazol-3-yl)-1-N-benzylpiperazine-1,4-dicarboxamide (PubChem CID 68777853) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 4-N-(1,2-benzoxazol-3-yl)-1-N-benzylpiperazine-1,4-dicarboxamide.
| Compound Name | 4-N-(1,2-benzoxazol-3-yl)-1-N-benzylpiperazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 68777853 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-N-(1,2-benzoxazol-3-yl)-1-N-benzylpiperazine-1,4-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCN(C(=O)Nc2noc3ccccc23)CC1 |
| InChI | InChI=1S/C20H21N5O3/c26-19(21-14-15-6-2-1-3-7-15)24-10-12-25(13-11-24)20(27)22-18-16-8-4-5-9-17(16)28-23-18/h1-9H,10-14H2,(H,21,26)(H,22,23,27) |
| InChIKey | SAQKHJWGTUVJDN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |