C27H30N4O2 — CID 25129699
N-(1,2-benzoxazol-3-yl)-4-[[3-(2-cyclohexylethynyl)phenyl]methyl]piperazine-1-carboxamide (PubChem CID 25129699) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-(1,2-benzoxazol-3-yl)-4-[[3-(2-cyclohexylethynyl)phenyl]methyl]piperazine-1-carboxamide.
| Compound Name | N-(1,2-benzoxazol-3-yl)-4-[[3-(2-cyclohexylethynyl)phenyl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 25129699 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | N-(1,2-benzoxazol-3-yl)-4-[[3-(2-cyclohexylethynyl)phenyl]methyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1noc2ccccc12)N1CCN(Cc2cccc(C#CC3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C27H30N4O2/c32-27(28-26-24-11-4-5-12-25(24)33-29-26)31-17-15-30(16-18-31)20-23-10-6-9-22(19-23)14-13-21-7-2-1-3-8-21/h4-6,9-12,19,21H,1-3,7-8,15-18,20H2,(H,28,29,32) |
| InChIKey | PASWJNPFAMLHBX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|