C24H28N4O2Si — CID 68725099
N-(1,2-benzoxazol-3-yl)-4-[[3-(2-trimethylsilylethynyl)phenyl]methyl]piperazine-1-carboxamide (PubChem CID 68725099) has the molecular formula C24H28N4O2Si and a molecular weight of 432.60 g/mol. Its IUPAC name is N-(1,2-benzoxazol-3-yl)-4-[[3-(2-trimethylsilylethynyl)phenyl]methyl]piperazine-1-carboxamide.
| Compound Name | N-(1,2-benzoxazol-3-yl)-4-[[3-(2-trimethylsilylethynyl)phenyl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 68725099 |
| Molecular Formula | C24H28N4O2Si |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-(1,2-benzoxazol-3-yl)-4-[[3-(2-trimethylsilylethynyl)phenyl]methyl]piperazine-1-carboxamide |
| SMILES | C[Si](C)(C)C#Cc1cccc(CN2CCN(C(=O)Nc3noc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C24H28N4O2Si/c1-31(2,3)16-11-19-7-6-8-20(17-19)18-27-12-14-28(15-13-27)24(29)25-23-21-9-4-5-10-22(21)30-26-23/h4-10,17H,12-15,18H2,1-3H3,(H,25,26,29) |
| InChIKey | VCPGKKAYOWTWED-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|