C20H20N4O4 — CID 68780053
benzyl 4-(1,2-benzoxazol-3-ylcarbamoyl)piperazine-1-carboxylate (PubChem CID 68780053) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is benzyl 4-(1,2-benzoxazol-3-ylcarbamoyl)piperazine-1-carboxylate.
| Compound Name | benzyl 4-(1,2-benzoxazol-3-ylcarbamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 68780053 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | benzyl 4-(1,2-benzoxazol-3-ylcarbamoyl)piperazine-1-carboxylate |
| SMILES | O=C(Nc1noc2ccccc12)N1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H20N4O4/c25-19(21-18-16-8-4-5-9-17(16)28-22-18)23-10-12-24(13-11-23)20(26)27-14-15-6-2-1-3-7-15/h1-9H,10-14H2,(H,21,22,25) |
| InChIKey | DWYDCKYDOQOXCA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |