C16H19N3O3 — CID 110645892
benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate (PubChem CID 110645892) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate.
| Compound Name | benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110645892 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate |
| SMILES | Cc1cc(N2CCN(C(=O)OCc3ccccc3)CC2)no1 |
| InChI | InChI=1S/C16H19N3O3/c1-13-11-15(17-22-13)18-7-9-19(10-8-18)16(20)21-12-14-5-3-2-4-6-14/h2-6,11H,7-10,12H2,1H3 |
| InChIKey | VOFSBBKOXFCCCU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |