benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate

C16H19N3O3 — CID 110645892

IUPACbenzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate
SMILESCc1cc(N2CCN(C(=O)OCc3ccccc3)CC2)no1
InChIInChI=1S/C16H19N3O3/c1-13-11-15(17-22-13)18-7-9-19(10-8-18)16(20)21-12-14-5-3-2-4-6-14/h2-6,11H,7-10,12H2,1H3
InChIKeyVOFSBBKOXFCCCU-UHFFFAOYSA-N
MW301.35 g/mol
LogP2.44
Rot. Bonds3

About benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate

benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate (PubChem CID 110645892) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate.

Molecular Properties

Compound Namebenzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate
PubChem CID110645892
Molecular FormulaC16H19N3O3
Molecular Weight301.35 g/mol
Exact Mass301.14
IUPAC Namebenzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate
SMILESCc1cc(N2CCN(C(=O)OCc3ccccc3)CC2)no1
InChIInChI=1S/C16H19N3O3/c1-13-11-15(17-22-13)18-7-9-19(10-8-18)16(20)21-12-14-5-3-2-4-6-14/h2-6,11H,7-10,12H2,1H3
InChIKeyVOFSBBKOXFCCCU-UHFFFAOYSA-N
XLogP2.44
TPSA58.81 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.35
LogP ≤ 52.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate?
The IUPAC name of benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate (CID 110645892) is benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate.
What is the SMILES notation for benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate?
The canonical SMILES for benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate is Cc1cc(N2CCN(C(=O)OCc3ccccc3)CC2)no1.
What is the InChIKey of benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate?
The InChIKey is VOFSBBKOXFCCCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O3/c1-13-11-15(17-22-13)18-7-9-19(10-8-18)16(20)21-12-14-5-3-2-4-6-14/h2-6,11H,7-10,12H2,1H3.
What are the key properties of benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate?
benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate has a molecular weight of 301.35 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(5-methyl-1,2-oxazol-3-yl)piperazine-1-carboxylate is sourced from PubChem (CID 110645892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).