C19H19N5O2 — CID 133397587
benzyl 4-pyrido[2,3-b]pyrazin-6-ylpiperazine-1-carboxylate (PubChem CID 133397587) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is benzyl 4-pyrido[2,3-b]pyrazin-6-ylpiperazine-1-carboxylate.
| Compound Name | benzyl 4-pyrido[2,3-b]pyrazin-6-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 133397587 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | benzyl 4-pyrido[2,3-b]pyrazin-6-ylpiperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(c2ccc3nccnc3n2)CC1 |
| InChI | InChI=1S/C19H19N5O2/c25-19(26-14-15-4-2-1-3-5-15)24-12-10-23(11-13-24)17-7-6-16-18(22-17)21-9-8-20-16/h1-9H,10-14H2 |
| InChIKey | YZHITRMULSOZKZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |