C20H19ClN4O2 — CID 168978371
benzyl 4-(7-chloro-1,8-naphthyridin-3-yl)piperazine-1-carboxylate (PubChem CID 168978371) has the molecular formula C20H19ClN4O2 and a molecular weight of 382.85 g/mol. Its IUPAC name is benzyl 4-(7-chloro-1,8-naphthyridin-3-yl)piperazine-1-carboxylate.
| Compound Name | benzyl 4-(7-chloro-1,8-naphthyridin-3-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168978371 |
| Molecular Formula | C20H19ClN4O2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | benzyl 4-(7-chloro-1,8-naphthyridin-3-yl)piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(c2cnc3nc(Cl)ccc3c2)CC1 |
| InChI | InChI=1S/C20H19ClN4O2/c21-18-7-6-16-12-17(13-22-19(16)23-18)24-8-10-25(11-9-24)20(26)27-14-15-4-2-1-3-5-15/h1-7,12-13H,8-11,14H2 |
| InChIKey | SMQWPECVXNDBLX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|