C23H21ClF3N5O2 — CID 87266599
benzyl 4-[4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 87266599) has the molecular formula C23H21ClF3N5O2 and a molecular weight of 491.90 g/mol. Its IUPAC name is benzyl 4-[4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87266599 |
| Molecular Formula | C23H21ClF3N5O2 |
| Molecular Weight | 491.90 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | benzyl 4-[4-[[4-chloro-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(c2ccc(Nc3ncc(C(F)(F)F)c(Cl)n3)cc2)CC1 |
| InChI | InChI=1S/C23H21ClF3N5O2/c24-20-19(23(25,26)27)14-28-21(30-20)29-17-6-8-18(9-7-17)31-10-12-32(13-11-31)22(33)34-15-16-4-2-1-3-5-16/h1-9,14H,10-13,15H2,(H,28,29,30) |
| InChIKey | ZVJSXBPUXOCHRX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.90 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|