C29H33F3LiN5O4 — CID 175282525
lithium;benzoic acid;tert-butyl 4-[4-[[4-ethyl-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 175282525) has the molecular formula C29H33F3LiN5O4 and a molecular weight of 579.55 g/mol. Its IUPAC name is lithium;benzoic acid;tert-butyl 4-[4-[[4-ethyl-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | lithium;benzoic acid;tert-butyl 4-[4-[[4-ethyl-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175282525 |
| Molecular Formula | C29H33F3LiN5O4 |
| Molecular Weight | 579.55 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | lithium;benzoic acid;tert-butyl 4-[4-[[4-ethyl-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | O=C(O)c1ccccc1.[CH2-]Cc1nc(Nc2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)ncc1C(F)(F)F.[Li+] |
| InChI | InChI=1S/C22H27F3N5O2.C7H6O2.Li/c1-5-18-17(22(23,24)25)14-26-19(28-18)27-15-6-8-16(9-7-15)29-10-12-30(13-11-29)20(31)32-21(2,3)4;8-7(9)6-4-2-1-3-5-6;/h6-9,14H,1,5,10-13H2,2-4H3,(H,26,27,28);1-5H,(H,8,9);/q-1;;+1 |
| InChIKey | GRWYNKRDWFCRMQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|