C31H36F3LiN4O4 — CID 174711740
lithium;acetic acid;tert-butyl 4-[4-[[4-(2-phenylethyl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidine-1-carboxylate (PubChem CID 174711740) has the molecular formula C31H36F3LiN4O4 and a molecular weight of 592.59 g/mol. Its IUPAC name is lithium;acetic acid;tert-butyl 4-[4-[[4-(2-phenylethyl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidine-1-carboxylate.
| Compound Name | lithium;acetic acid;tert-butyl 4-[4-[[4-(2-phenylethyl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174711740 |
| Molecular Formula | C31H36F3LiN4O4 |
| Molecular Weight | 592.59 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | lithium;acetic acid;tert-butyl 4-[4-[[4-(2-phenylethyl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidine-1-carboxylate |
| SMILES | CC(=O)O.CC(C)(C)OC(=O)N1CCC(c2ccc(Nc3ncc(C(F)(F)F)c(CCc4[c-]cccc4)n3)cc2)CC1.[Li+] |
| InChI | InChI=1S/C29H32F3N4O2.C2H4O2.Li/c1-28(2,3)38-27(37)36-17-15-22(16-18-36)21-10-12-23(13-11-21)34-26-33-19-24(29(30,31)32)25(35-26)14-9-20-7-5-4-6-8-20;1-2(3)4;/h4-7,10-13,19,22H,9,14-18H2,1-3H3,(H,33,34,35);1H3,(H,3,4);/q-1;;+1 |
| InChIKey | ZMHOEKIVEXSZFW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|