C27H29ClF3N5O3 — CID 171779491
tert-butyl 4-[4-[[6-[(2-chloroacetyl)amino]-4-(trifluoromethyl)quinolin-2-yl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 171779491) has the molecular formula C27H29ClF3N5O3 and a molecular weight of 564.01 g/mol. Its IUPAC name is tert-butyl 4-[4-[[6-[(2-chloroacetyl)amino]-4-(trifluoromethyl)quinolin-2-yl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[6-[(2-chloroacetyl)amino]-4-(trifluoromethyl)quinolin-2-yl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171779491 |
| Molecular Formula | C27H29ClF3N5O3 |
| Molecular Weight | 564.01 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | tert-butyl 4-[4-[[6-[(2-chloroacetyl)amino]-4-(trifluoromethyl)quinolin-2-yl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Nc3cc(C(F)(F)F)c4cc(NC(=O)CCl)ccc4n3)cc2)CC1 |
| InChI | InChI=1S/C27H29ClF3N5O3/c1-26(2,3)39-25(38)36-12-10-35(11-13-36)19-7-4-17(5-8-19)32-23-15-21(27(29,30)31)20-14-18(33-24(37)16-28)6-9-22(20)34-23/h4-9,14-15H,10-13,16H2,1-3H3,(H,32,34)(H,33,37) |
| InChIKey | QQRKMDRLWNBLGV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.01 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|