C21H21F3N4 — CID 171779420
N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethyl)quinolin-2-amine (PubChem CID 171779420) has the molecular formula C21H21F3N4 and a molecular weight of 386.42 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethyl)quinolin-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethyl)quinolin-2-amine |
|---|---|
| PubChem CID | 171779420 |
| Molecular Formula | C21H21F3N4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(trifluoromethyl)quinolin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3cc(C(F)(F)F)c4ccccc4n3)cc2)CC1 |
| InChI | InChI=1S/C21H21F3N4/c1-27-10-12-28(13-11-27)16-8-6-15(7-9-16)25-20-14-18(21(22,23)24)17-4-2-3-5-19(17)26-20/h2-9,14H,10-13H2,1H3,(H,25,26) |
| InChIKey | GFOJGQRBQLPKDX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|