C26H29F3N4O3 — CID 171779469
tert-butyl 4-[4-[[6-methoxy-4-(trifluoromethyl)quinolin-2-yl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 171779469) has the molecular formula C26H29F3N4O3 and a molecular weight of 502.54 g/mol. Its IUPAC name is tert-butyl 4-[4-[[6-methoxy-4-(trifluoromethyl)quinolin-2-yl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[6-methoxy-4-(trifluoromethyl)quinolin-2-yl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171779469 |
| Molecular Formula | C26H29F3N4O3 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | tert-butyl 4-[4-[[6-methoxy-4-(trifluoromethyl)quinolin-2-yl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | COc1ccc2nc(Nc3ccc(N4CCN(C(=O)OC(C)(C)C)CC4)cc3)cc(C(F)(F)F)c2c1 |
| InChI | InChI=1S/C26H29F3N4O3/c1-25(2,3)36-24(34)33-13-11-32(12-14-33)18-7-5-17(6-8-18)30-23-16-21(26(27,28)29)20-15-19(35-4)9-10-22(20)31-23/h5-10,15-16H,11-14H2,1-4H3,(H,30,31) |
| InChIKey | YGVDCSYJGOEFDK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|