C20H26ClN5O2 — CID 122632123
tert-butyl 4-[4-chloro-6-(4-methylanilino)pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 122632123) has the molecular formula C20H26ClN5O2 and a molecular weight of 403.91 g/mol. Its IUPAC name is tert-butyl 4-[4-chloro-6-(4-methylanilino)pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-chloro-6-(4-methylanilino)pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122632123 |
| Molecular Formula | C20H26ClN5O2 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | tert-butyl 4-[4-chloro-6-(4-methylanilino)pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(Nc2cc(Cl)nc(N3CCN(C(=O)OC(C)(C)C)CC3)n2)cc1 |
| InChI | InChI=1S/C20H26ClN5O2/c1-14-5-7-15(8-6-14)22-17-13-16(21)23-18(24-17)25-9-11-26(12-10-25)19(27)28-20(2,3)4/h5-8,13H,9-12H2,1-4H3,(H,22,23,24) |
| InChIKey | KIKFNVGIZRXAEK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |